C8H3BrF7N — CID 66512670
(1R)-1-(4-bromo-2,3,5,6-tetrafluorophenyl)-2,2,2-trifluoroethanamine (PubChem CID 66512670) has the molecular formula C8H3BrF7N and a molecular weight of 326.01 g/mol. Its IUPAC name is (1R)-1-(4-bromo-2,3,5,6-tetrafluorophenyl)-2,2,2-trifluoroethanamine.
| Compound Name | (1R)-1-(4-bromo-2,3,5,6-tetrafluorophenyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 66512670 |
| Molecular Formula | C8H3BrF7N |
| Molecular Weight | 326.01 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | (1R)-1-(4-bromo-2,3,5,6-tetrafluorophenyl)-2,2,2-trifluoroethanamine |
| SMILES | N[C@H](c1c(F)c(F)c(Br)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C8H3BrF7N/c9-2-5(12)3(10)1(4(11)6(2)13)7(17)8(14,15)16/h7H,17H2/t7-/m1/s1 |
| InChIKey | QCPKWNWIJXWKGF-SSDOTTSWSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.01 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|