About (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid
(2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid (PubChem CID 66512756) has the molecular formula C12H17NO5
and a molecular weight of 255.27 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid |
| PubChem CID | 66512756 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid |
| SMILES | COc1c(C)c(OC)c(O)c([C@H](N)C(=O)O)c1C |
| InChI | InChI=1S/C12H17NO5/c1-5-7(8(13)12(15)16)9(14)11(18-4)6(2)10(5)17-3/h8,14H,13H2,1-4H3,(H,15,16)/t8-/m0/s1 |
| InChIKey | GJMGXZXGUUOFBM-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid?
The IUPAC name of (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid (CID 66512756) is (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid.
What is the SMILES notation for (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid?
The canonical SMILES for (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid is COc1c(C)c(OC)c(O)c([C@H](N)C(=O)O)c1C.
What is the InChIKey of (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid?
The InChIKey is GJMGXZXGUUOFBM-QMMMGPOBSA-N. The full InChI is InChI=1S/C12H17NO5/c1-5-7(8(13)12(15)16)9(14)11(18-4)6(2)10(5)17-3/h8,14H,13H2,1-4H3,(H,15,16)/t8-/m0/s1.
What are the key properties of (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid?
(2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid has a molecular weight of 255.27 g/mol, XLogP of 1.11, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(2-hydroxy-3,5-dimethoxy-4,6-dimethylphenyl)acetic acid is sourced from PubChem (CID 66512756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).