C18H23N3O2S — CID 665148
3,3-dimethyl-1-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butan-2-one (PubChem CID 665148) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 3,3-dimethyl-1-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 665148 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3,3-dimethyl-1-[[5-(phenoxymethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]butan-2-one |
| SMILES | C=CCn1c(COc2ccccc2)nnc1SCC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H23N3O2S/c1-5-11-21-16(12-23-14-9-7-6-8-10-14)19-20-17(21)24-13-15(22)18(2,3)4/h5-10H,1,11-13H2,2-4H3 |
| InChIKey | SYEPVLNXRVXGNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|