C24H28N2O5 — CID 665151
3,4,5-triethoxy-N-methyl-N-[(2-oxo-1H-quinolin-3-yl)methyl]benzamide (PubChem CID 665151) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-methyl-N-[(2-oxo-1H-quinolin-3-yl)methyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-methyl-N-[(2-oxo-1H-quinolin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 665151 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3,4,5-triethoxy-N-methyl-N-[(2-oxo-1H-quinolin-3-yl)methyl]benzamide |
| SMILES | CCOc1cc(C(=O)N(C)Cc2cc3ccccc3[nH]c2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H28N2O5/c1-5-29-20-13-17(14-21(30-6-2)22(20)31-7-3)24(28)26(4)15-18-12-16-10-8-9-11-19(16)25-23(18)27/h8-14H,5-7,15H2,1-4H3,(H,25,27) |
| InChIKey | BQJSWEQFIMDGEW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |