About (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol
(2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol (PubChem CID 66515135) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol.
Molecular Properties
| Compound Name | (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol |
| PubChem CID | 66515135 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol |
| SMILES | CCOc1cccc([C@H](N)CO)c1OCC |
| InChI | InChI=1S/C12H19NO3/c1-3-15-11-7-5-6-9(10(13)8-14)12(11)16-4-2/h5-7,10,14H,3-4,8,13H2,1-2H3/t10-/m1/s1 |
| InChIKey | RRNKZTWRKTXFEM-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol?
The IUPAC name of (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol (CID 66515135) is (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol.
What is the SMILES notation for (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol?
The canonical SMILES for (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol is CCOc1cccc([C@H](N)CO)c1OCC.
What is the InChIKey of (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol?
The InChIKey is RRNKZTWRKTXFEM-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H19NO3/c1-3-15-11-7-5-6-9(10(13)8-14)12(11)16-4-2/h5-7,10,14H,3-4,8,13H2,1-2H3/t10-/m1/s1.
What are the key properties of (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol?
(2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol has a molecular weight of 225.29 g/mol, XLogP of 1.48, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(2,3-diethoxyphenyl)ethanol is sourced from PubChem (CID 66515135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).