C10H14BrNO2 — CID 66515348
2-[(1S)-1-amino-2-hydroxyethyl]-6-bromo-4-ethylphenol (PubChem CID 66515348) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2-hydroxyethyl]-6-bromo-4-ethylphenol.
| Compound Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-bromo-4-ethylphenol |
|---|---|
| PubChem CID | 66515348 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-[(1S)-1-amino-2-hydroxyethyl]-6-bromo-4-ethylphenol |
| SMILES | CCc1cc(Br)c(O)c([C@H](N)CO)c1 |
| InChI | InChI=1S/C10H14BrNO2/c1-2-6-3-7(9(12)5-13)10(14)8(11)4-6/h3-4,9,13-14H,2,5,12H2,1H3/t9-/m1/s1 |
| InChIKey | XSTNNGJQOYTYRP-SECBINFHSA-N |
| XLogP | 1.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|