About (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine
(1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine (PubChem CID 66517168) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine |
| PubChem CID | 66517168 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine |
| SMILES | CCc1cc([C@H](N)CN)cc(CC)c1N |
| InChI | InChI=1S/C12H21N3/c1-3-8-5-10(11(14)7-13)6-9(4-2)12(8)15/h5-6,11H,3-4,7,13-15H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZCKKCVRECVOBKT-LLVKDONJSA-N |
| XLogP | 1.35 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine?
The IUPAC name of (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine (CID 66517168) is (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine.
What is the SMILES notation for (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine?
The canonical SMILES for (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine is CCc1cc([C@H](N)CN)cc(CC)c1N.
What is the InChIKey of (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine?
The InChIKey is ZCKKCVRECVOBKT-LLVKDONJSA-N. The full InChI is InChI=1S/C12H21N3/c1-3-8-5-10(11(14)7-13)6-9(4-2)12(8)15/h5-6,11H,3-4,7,13-15H2,1-2H3/t11-/m1/s1.
What are the key properties of (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine?
(1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine has a molecular weight of 207.32 g/mol, XLogP of 1.35, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-amino-3,5-diethylphenyl)ethane-1,2-diamine is sourced from PubChem (CID 66517168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).