C13H21N3 — CID 66517550
(1S)-1-(2-methyl-4-pyrrolidin-1-ylphenyl)ethane-1,2-diamine (PubChem CID 66517550) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (1S)-1-(2-methyl-4-pyrrolidin-1-ylphenyl)ethane-1,2-diamine.
| Compound Name | (1S)-1-(2-methyl-4-pyrrolidin-1-ylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517550 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (1S)-1-(2-methyl-4-pyrrolidin-1-ylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(N2CCCC2)ccc1[C@H](N)CN |
| InChI | InChI=1S/C13H21N3/c1-10-8-11(16-6-2-3-7-16)4-5-12(10)13(15)9-14/h4-5,8,13H,2-3,6-7,9,14-15H2,1H3/t13-/m1/s1 |
| InChIKey | OXRRBAPKRIAIQB-CYBMUJFWSA-N |
| XLogP | 1.55 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|