C12H14ClNO — CID 66519243
(2S)-2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)pyrrolidine (PubChem CID 66519243) has the molecular formula C12H14ClNO and a molecular weight of 223.70 g/mol. Its IUPAC name is (2S)-2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)pyrrolidine.
| Compound Name | (2S)-2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)pyrrolidine |
|---|---|
| PubChem CID | 66519243 |
| Molecular Formula | C12H14ClNO |
| Molecular Weight | 223.70 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (2S)-2-(5-chloro-2,3-dihydro-1-benzofuran-7-yl)pyrrolidine |
| SMILES | Clc1cc2c(c([C@@H]3CCCN3)c1)OCC2 |
| InChI | InChI=1S/C12H14ClNO/c13-9-6-8-3-5-15-12(8)10(7-9)11-2-1-4-14-11/h6-7,11,14H,1-5H2/t11-/m0/s1 |
| InChIKey | LQMGFKDIECHIBX-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.70 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |