C11H8Cl2N2O — CID 665194
5,8-dichloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one (PubChem CID 665194) has the molecular formula C11H8Cl2N2O and a molecular weight of 255.10 g/mol. Its IUPAC name is 5,8-dichloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one.
| Compound Name | 5,8-dichloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 665194 |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 5,8-dichloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES | O=C1NCCc2c1[nH]c1c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C11H8Cl2N2O/c12-6-1-2-7(13)10-8(6)5-3-4-14-11(16)9(5)15-10/h1-2,15H,3-4H2,(H,14,16) |
| InChIKey | VJUGVVOGVWAGRV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |