C13H16ClN — CID 66519431
(2S)-2-(7-chloro-2,3-dihydro-1H-inden-5-yl)pyrrolidine (PubChem CID 66519431) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is (2S)-2-(7-chloro-2,3-dihydro-1H-inden-5-yl)pyrrolidine.
| Compound Name | (2S)-2-(7-chloro-2,3-dihydro-1H-inden-5-yl)pyrrolidine |
|---|---|
| PubChem CID | 66519431 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (2S)-2-(7-chloro-2,3-dihydro-1H-inden-5-yl)pyrrolidine |
| SMILES | Clc1cc([C@@H]2CCCN2)cc2c1CCC2 |
| InChI | InChI=1S/C13H16ClN/c14-12-8-10(13-5-2-6-15-13)7-9-3-1-4-11(9)12/h7-8,13,15H,1-6H2/t13-/m0/s1 |
| InChIKey | NCIJVBOWEFOUFO-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |