C13H17N3O3 — CID 66519979
(2S)-2-azido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid (PubChem CID 66519979) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is (2S)-2-azido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-azido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66519979 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (2S)-2-azido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)Oc1ccc(C[C@H](N=[N+]=[N-])C(=O)O)cc1 |
| InChI | InChI=1S/C13H17N3O3/c1-13(2,3)19-10-6-4-9(5-7-10)8-11(12(17)18)15-16-14/h4-7,11H,8H2,1-3H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | OHSZZGXUYAWJQW-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|