About 2-pyrrol-1-yl-1,3-thiazol-5-amine
2-pyrrol-1-yl-1,3-thiazol-5-amine (PubChem CID 66520589) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is 2-pyrrol-1-yl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-pyrrol-1-yl-1,3-thiazol-5-amine |
| PubChem CID | 66520589 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 2-pyrrol-1-yl-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(-n2cccc2)s1 |
| InChI | InChI=1S/C7H7N3S/c8-6-5-9-7(11-6)10-3-1-2-4-10/h1-5H,8H2 |
| InChIKey | JVYZDDNLNRHPOK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrrol-1-yl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrol-1-yl-1,3-thiazol-5-amine?
The IUPAC name of 2-pyrrol-1-yl-1,3-thiazol-5-amine (CID 66520589) is 2-pyrrol-1-yl-1,3-thiazol-5-amine.
What is the SMILES notation for 2-pyrrol-1-yl-1,3-thiazol-5-amine?
The canonical SMILES for 2-pyrrol-1-yl-1,3-thiazol-5-amine is Nc1cnc(-n2cccc2)s1.
What is the InChIKey of 2-pyrrol-1-yl-1,3-thiazol-5-amine?
The InChIKey is JVYZDDNLNRHPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c8-6-5-9-7(11-6)10-3-1-2-4-10/h1-5H,8H2.
What are the key properties of 2-pyrrol-1-yl-1,3-thiazol-5-amine?
2-pyrrol-1-yl-1,3-thiazol-5-amine has a molecular weight of 165.22 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrol-1-yl-1,3-thiazol-5-amine is sourced from PubChem (CID 66520589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).