About 3-(4-bromophenyl)oxolane
3-(4-bromophenyl)oxolane (PubChem CID 66521185) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 3-(4-bromophenyl)oxolane.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)oxolane |
| PubChem CID | 66521185 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 3-(4-bromophenyl)oxolane |
| SMILES | Brc1ccc(C2CCOC2)cc1 |
| InChI | InChI=1S/C10H11BrO/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-4,9H,5-7H2 |
| InChIKey | JAVFDQBREKPGPG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-bromophenyl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)oxolane?
The IUPAC name of 3-(4-bromophenyl)oxolane (CID 66521185) is 3-(4-bromophenyl)oxolane.
What is the SMILES notation for 3-(4-bromophenyl)oxolane?
The canonical SMILES for 3-(4-bromophenyl)oxolane is Brc1ccc(C2CCOC2)cc1.
What is the InChIKey of 3-(4-bromophenyl)oxolane?
The InChIKey is JAVFDQBREKPGPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO/c11-10-3-1-8(2-4-10)9-5-6-12-7-9/h1-4,9H,5-7H2.
What are the key properties of 3-(4-bromophenyl)oxolane?
3-(4-bromophenyl)oxolane has a molecular weight of 227.10 g/mol, XLogP of 2.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)oxolane is sourced from PubChem (CID 66521185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).