About 2,5-dibromo-4-propan-2-yl-1,3-thiazole
2,5-dibromo-4-propan-2-yl-1,3-thiazole (PubChem CID 66521220) has the molecular formula C6H7Br2NS
and a molecular weight of 285.00 g/mol. Its IUPAC name is 2,5-dibromo-4-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2,5-dibromo-4-propan-2-yl-1,3-thiazole |
| PubChem CID | 66521220 |
| Molecular Formula | C6H7Br2NS |
| Molecular Weight | 285.00 g/mol |
| Exact Mass | 282.87 |
| IUPAC Name | 2,5-dibromo-4-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1nc(Br)sc1Br |
| InChI | InChI=1S/C6H7Br2NS/c1-3(2)4-5(7)10-6(8)9-4/h3H,1-2H3 |
| InChIKey | GWTPSENJWBIAKO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5-dibromo-4-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromo-4-propan-2-yl-1,3-thiazole?
The IUPAC name of 2,5-dibromo-4-propan-2-yl-1,3-thiazole (CID 66521220) is 2,5-dibromo-4-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 2,5-dibromo-4-propan-2-yl-1,3-thiazole?
The canonical SMILES for 2,5-dibromo-4-propan-2-yl-1,3-thiazole is CC(C)c1nc(Br)sc1Br.
What is the InChIKey of 2,5-dibromo-4-propan-2-yl-1,3-thiazole?
The InChIKey is GWTPSENJWBIAKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Br2NS/c1-3(2)4-5(7)10-6(8)9-4/h3H,1-2H3.
What are the key properties of 2,5-dibromo-4-propan-2-yl-1,3-thiazole?
2,5-dibromo-4-propan-2-yl-1,3-thiazole has a molecular weight of 285.00 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromo-4-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 66521220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).