About 3-cyclobutylaniline
3-cyclobutylaniline (PubChem CID 66521271) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-cyclobutylaniline.
Molecular Properties
| Compound Name | 3-cyclobutylaniline |
| PubChem CID | 66521271 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-cyclobutylaniline |
| SMILES | Nc1cccc(C2CCC2)c1 |
| InChI | InChI=1S/C10H13N/c11-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8H,1,3-4,11H2 |
| InChIKey | CJJBVKSLLOQPKD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutylaniline?
The IUPAC name of 3-cyclobutylaniline (CID 66521271) is 3-cyclobutylaniline.
What is the SMILES notation for 3-cyclobutylaniline?
The canonical SMILES for 3-cyclobutylaniline is Nc1cccc(C2CCC2)c1.
What is the InChIKey of 3-cyclobutylaniline?
The InChIKey is CJJBVKSLLOQPKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c11-10-6-2-5-9(7-10)8-3-1-4-8/h2,5-8H,1,3-4,11H2.
What are the key properties of 3-cyclobutylaniline?
3-cyclobutylaniline has a molecular weight of 147.22 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutylaniline is sourced from PubChem (CID 66521271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).