About 3-(3-bromophenyl)oxane
3-(3-bromophenyl)oxane (PubChem CID 66521400) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 3-(3-bromophenyl)oxane.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)oxane |
| PubChem CID | 66521400 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 3-(3-bromophenyl)oxane |
| SMILES | Brc1cccc(C2CCCOC2)c1 |
| InChI | InChI=1S/C11H13BrO/c12-11-5-1-3-9(7-11)10-4-2-6-13-8-10/h1,3,5,7,10H,2,4,6,8H2 |
| InChIKey | MSBRJBBFRPFUAY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-bromophenyl)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)oxane?
The IUPAC name of 3-(3-bromophenyl)oxane (CID 66521400) is 3-(3-bromophenyl)oxane.
What is the SMILES notation for 3-(3-bromophenyl)oxane?
The canonical SMILES for 3-(3-bromophenyl)oxane is Brc1cccc(C2CCCOC2)c1.
What is the InChIKey of 3-(3-bromophenyl)oxane?
The InChIKey is MSBRJBBFRPFUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c12-11-5-1-3-9(7-11)10-4-2-6-13-8-10/h1,3,5,7,10H,2,4,6,8H2.
What are the key properties of 3-(3-bromophenyl)oxane?
3-(3-bromophenyl)oxane has a molecular weight of 241.13 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)oxane is sourced from PubChem (CID 66521400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).