C7H7Br2NS — CID 66521426
4,5-dibromo-2-cyclobutyl-1,3-thiazole (PubChem CID 66521426) has the molecular formula C7H7Br2NS and a molecular weight of 297.02 g/mol. Its IUPAC name is 4,5-dibromo-2-cyclobutyl-1,3-thiazole.
| Compound Name | 4,5-dibromo-2-cyclobutyl-1,3-thiazole |
|---|---|
| PubChem CID | 66521426 |
| Molecular Formula | C7H7Br2NS |
| Molecular Weight | 297.02 g/mol |
| Exact Mass | 294.87 |
| IUPAC Name | 4,5-dibromo-2-cyclobutyl-1,3-thiazole |
| SMILES | Brc1nc(C2CCC2)sc1Br |
| InChI | InChI=1S/C7H7Br2NS/c8-5-6(9)11-7(10-5)4-2-1-3-4/h4H,1-3H2 |
| InChIKey | RXXBFGXGNPQFEO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.02 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |