C15H25BN2O2S — CID 66521513
2-(2-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (PubChem CID 66521513) has the molecular formula C15H25BN2O2S and a molecular weight of 308.26 g/mol. Its IUPAC name is 2-(2-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole.
| Compound Name | 2-(2-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 66521513 |
| Molecular Formula | C15H25BN2O2S |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-(2-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| SMILES | CC1CCCCN1c1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C15H25BN2O2S/c1-11-8-6-7-9-18(11)13-17-10-12(21-13)16-19-14(2,3)15(4,5)20-16/h10-11H,6-9H2,1-5H3 |
| InChIKey | UONSZWQWAFWYLN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|