About 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide
2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide (PubChem CID 66521679) has the molecular formula C19H20BrNO4
and a molecular weight of 406.28 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide.
Molecular Properties
| Compound Name | 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide |
| PubChem CID | 66521679 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide |
| SMILES | Br.COc1ccc2c(=O)cc(-c3ccc(N(C)C)cc3)oc2c1OC |
| InChI | InChI=1S/C19H19NO4.BrH/c1-20(2)13-7-5-12(6-8-13)17-11-15(21)14-9-10-16(22-3)19(23-4)18(14)24-17;/h5-11H,1-4H3;1H |
| InChIKey | XQSSTERYBODMAJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide?
The IUPAC name of 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide (CID 66521679) is 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide.
What is the SMILES notation for 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide?
The canonical SMILES for 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide is Br.COc1ccc2c(=O)cc(-c3ccc(N(C)C)cc3)oc2c1OC.
What is the InChIKey of 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide?
The InChIKey is XQSSTERYBODMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4.BrH/c1-20(2)13-7-5-12(6-8-13)17-11-15(21)14-9-10-16(22-3)19(23-4)18(14)24-17;/h5-11H,1-4H3;1H.
What are the key properties of 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide?
2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide has a molecular weight of 406.28 g/mol, XLogP of 4.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(dimethylamino)phenyl]-7,8-dimethoxychromen-4-one;hydrobromide is sourced from PubChem (CID 66521679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).