About [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride
[5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride (PubChem CID 66521928) has the molecular formula C14H21ClN2O3
and a molecular weight of 300.79 g/mol. Its IUPAC name is [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride |
| PubChem CID | 66521928 |
| Molecular Formula | C14H21ClN2O3 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride |
| SMILES | CC(C)C(=O)Nc1ccc(N)cc1OC(=O)C(C)C.Cl |
| InChI | InChI=1S/C14H20N2O3.ClH/c1-8(2)13(17)16-11-6-5-10(15)7-12(11)19-14(18)9(3)4;/h5-9H,15H2,1-4H3,(H,16,17);1H |
| InChIKey | LYAGDQPLVUPXPO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride?
The IUPAC name of [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride (CID 66521928) is [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride.
What is the SMILES notation for [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride?
The canonical SMILES for [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride is CC(C)C(=O)Nc1ccc(N)cc1OC(=O)C(C)C.Cl.
What is the InChIKey of [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride?
The InChIKey is LYAGDQPLVUPXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O3.ClH/c1-8(2)13(17)16-11-6-5-10(15)7-12(11)19-14(18)9(3)4;/h5-9H,15H2,1-4H3,(H,16,17);1H.
What are the key properties of [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride?
[5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride has a molecular weight of 300.79 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-amino-2-(2-methylpropanoylamino)phenyl] 2-methylpropanoate;hydrochloride is sourced from PubChem (CID 66521928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).