C25H25N5O7 — CID 66522443
(5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 66522443) has the molecular formula C25H25N5O7 and a molecular weight of 507.50 g/mol. Its IUPAC name is (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 66522443 |
| Molecular Formula | C25H25N5O7 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | (5Z)-5-[[2-(4-acetylpiperazin-1-yl)-5-nitrophenyl]methylidene]-1-[(4-methoxyphenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(CN2C(=O)NC(=O)/C(=C/c3cc([N+](=O)[O-])ccc3N3CCN(C(C)=O)CC3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N5O7/c1-16(31)27-9-11-28(12-10-27)22-8-5-19(30(35)36)13-18(22)14-21-23(32)26-25(34)29(24(21)33)15-17-3-6-20(37-2)7-4-17/h3-8,13-14H,9-12,15H2,1-2H3,(H,26,32,34)/b21-14- |
| InChIKey | FXFQMFOXQAHFNA-STZFKDTASA-N |
| XLogP | 1.93 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|