About N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide
N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide (PubChem CID 66522821) has the molecular formula C12H19N3O4
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide |
| PubChem CID | 66522821 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide |
| SMILES | CCCCNC(=O)c1c(O)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H19N3O4/c1-3-5-6-13-9(16)8-10(17)14-12(19)15(7-4-2)11(8)18/h18H,3-7H2,1-2H3,(H,13,16)(H,14,17,19) |
| InChIKey | PXRDFOAMXJAVOJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide?
The IUPAC name of N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide (CID 66522821) is N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide.
What is the SMILES notation for N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide?
The canonical SMILES for N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide is CCCCNC(=O)c1c(O)n(CCC)c(=O)[nH]c1=O.
What is the InChIKey of N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide?
The InChIKey is PXRDFOAMXJAVOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4/c1-3-5-6-13-9(16)8-10(17)14-12(19)15(7-4-2)11(8)18/h18H,3-7H2,1-2H3,(H,13,16)(H,14,17,19).
What are the key properties of N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide?
N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide has a molecular weight of 269.30 g/mol, XLogP of 0.18, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-hydroxy-2,4-dioxo-1-propylpyrimidine-5-carboxamide is sourced from PubChem (CID 66522821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).