C17H28N4O4 — CID 66523397
tert-butyl 2-[2-(4-ethoxycarbonyltriazol-1-yl)ethyl]piperidine-1-carboxylate (PubChem CID 66523397) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-ethoxycarbonyltriazol-1-yl)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(4-ethoxycarbonyltriazol-1-yl)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66523397 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | tert-butyl 2-[2-(4-ethoxycarbonyltriazol-1-yl)ethyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1cn(CCC2CCCCN2C(=O)OC(C)(C)C)nn1 |
| InChI | InChI=1S/C17H28N4O4/c1-5-24-15(22)14-12-20(19-18-14)11-9-13-8-6-7-10-21(13)16(23)25-17(2,3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | LFQBLISROSYBTJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |