About [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol
[3-(pentafluoro-λ6-sulfanyl)phenyl]methanol (PubChem CID 66523452) has the molecular formula C7H7F5OS
and a molecular weight of 234.19 g/mol. Its IUPAC name is [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol.
Molecular Properties
| Compound Name | [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol |
| PubChem CID | 66523452 |
| Molecular Formula | C7H7F5OS |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol |
| SMILES | OCc1cccc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C7H7F5OS/c8-14(9,10,11,12)7-3-1-2-6(4-7)5-13/h1-4,13H,5H2 |
| InChIKey | ZKRNAZYJHXJIFR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol?
The IUPAC name of [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol (CID 66523452) is [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol.
What is the SMILES notation for [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol?
The canonical SMILES for [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol is OCc1cccc(S(F)(F)(F)(F)F)c1.
What is the InChIKey of [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol?
The InChIKey is ZKRNAZYJHXJIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F5OS/c8-14(9,10,11,12)7-3-1-2-6(4-7)5-13/h1-4,13H,5H2.
What are the key properties of [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol?
[3-(pentafluoro-λ6-sulfanyl)phenyl]methanol has a molecular weight of 234.19 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(pentafluoro-λ6-sulfanyl)phenyl]methanol is sourced from PubChem (CID 66523452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).