C8H6F6O2S — CID 66523545
2-[3-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid (PubChem CID 66523545) has the molecular formula C8H6F6O2S and a molecular weight of 280.19 g/mol. Its IUPAC name is 2-[3-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid.
| Compound Name | 2-[3-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 66523545 |
| Molecular Formula | C8H6F6O2S |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2-[3-fluoro-5-(pentafluoro-λ6-sulfanyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(F)cc(S(F)(F)(F)(F)F)c1 |
| InChI | InChI=1S/C8H6F6O2S/c9-6-1-5(3-8(15)16)2-7(4-6)17(10,11,12,13)14/h1-2,4H,3H2,(H,15,16) |
| InChIKey | IZLGUBFCHOPNJB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |