About 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide
5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide (PubChem CID 66523568) has the molecular formula C7H5ClF5NOS
and a molecular weight of 281.63 g/mol. Its IUPAC name is 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide.
Molecular Properties
| Compound Name | 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide |
| PubChem CID | 66523568 |
| Molecular Formula | C7H5ClF5NOS |
| Molecular Weight | 281.63 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C7H5ClF5NOS/c8-4-1-2-6(5(3-4)7(14)15)16(9,10,11,12)13/h1-3H,(H2,14,15) |
| InChIKey | AEYOQDOYHYIUJE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide?
The IUPAC name of 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide (CID 66523568) is 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide.
What is the SMILES notation for 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide?
The canonical SMILES for 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide is NC(=O)c1cc(Cl)ccc1S(F)(F)(F)(F)F.
What is the InChIKey of 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide?
The InChIKey is AEYOQDOYHYIUJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClF5NOS/c8-4-1-2-6(5(3-4)7(14)15)16(9,10,11,12)13/h1-3H,(H2,14,15).
What are the key properties of 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide?
5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide has a molecular weight of 281.63 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(pentafluoro-λ6-sulfanyl)benzamide is sourced from PubChem (CID 66523568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).