About (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
(3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 66524228) has the molecular formula C31H32F2O6S2
and a molecular weight of 602.72 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 66524228 |
| Molecular Formula | C31H32F2O6S2 |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | O=C(OCC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H32F2O6S2/c32-31(33,28(34)38-22-29-17-23-16-24(18-29)20-30(35,19-23)21-29)41(36,37)39-40(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,23-24,35H,16-22H2 |
| InChIKey | DDQWKNSXOTVLPN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 66524228) is (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is O=C(OCC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is DDQWKNSXOTVLPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32F2O6S2/c32-31(33,28(34)38-22-29-17-23-16-24(18-29)20-30(35,19-23)21-29)41(36,37)39-40(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-15,23-24,35H,16-22H2.
What are the key properties of (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
(3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 602.72 g/mol, XLogP of 6.70, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl)methyl 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 66524228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).