C20H28N4O3 — CID 665243
5-[3-(diethylamino)propyliminomethyl]-1-(2,3-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione (PubChem CID 665243) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5-[3-(diethylamino)propyliminomethyl]-1-(2,3-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 5-[3-(diethylamino)propyliminomethyl]-1-(2,3-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 665243 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 5-[3-(diethylamino)propyliminomethyl]-1-(2,3-dimethylphenyl)-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)CCC/N=C/c1c(O)n(-c2cccc(C)c2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H28N4O3/c1-5-23(6-2)12-8-11-21-13-16-18(25)22-20(27)24(19(16)26)17-10-7-9-14(3)15(17)4/h7,9-10,13,26H,5-6,8,11-12H2,1-4H3,(H,22,25,27)/b21-13+ |
| InChIKey | ZEAXXEXHCIBTGL-FYJGNVAPSA-N |
| XLogP | 2.00 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|