C10H18N2O4S3 — CID 66524356
(4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-3aH-thieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 66524356) has the molecular formula C10H18N2O4S3 and a molecular weight of 326.47 g/mol. Its IUPAC name is (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-3aH-thieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-3aH-thieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 66524356 |
| Molecular Formula | C10H18N2O4S3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (4S,6S)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-3aH-thieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCN[C@H]1C[C@H](C)S(=O)(=O)C2SC(S(N)(=O)=O)=CC21 |
| InChI | InChI=1S/C10H18N2O4S3/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16/h5-8,10,12H,3-4H2,1-2H3,(H2,11,15,16)/t6-,7?,8-,10?/m0/s1 |
| InChIKey | GKNQVLUQWYYZMY-XWDWJLIRSA-N |
| XLogP | -0.01 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |