About 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol
2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol (PubChem CID 66524567) has the molecular formula C27H29NO
and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol.
Molecular Properties
| Compound Name | 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol |
| PubChem CID | 66524567 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol |
| SMILES | C=CC[C@@H]1CCC[C@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C27H29NO/c1-2-12-23-17-11-19-25(21-13-5-3-6-14-21)28(23)27(22-15-7-4-8-16-22)24-18-9-10-20-26(24)29/h2-10,13-16,18,20,23,25,27,29H,1,11-12,17,19H2/t23-,25-,27?/m1/s1 |
| InChIKey | HEZDBBHSYFRFGF-KZIPUZRUSA-N |
| XLogP | 6.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol?
The IUPAC name of 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol (CID 66524567) is 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol.
What is the SMILES notation for 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol?
The canonical SMILES for 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol is C=CC[C@@H]1CCC[C@H](c2ccccc2)N1C(c1ccccc1)c1ccccc1O.
What is the InChIKey of 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol?
The InChIKey is HEZDBBHSYFRFGF-KZIPUZRUSA-N. The full InChI is InChI=1S/C27H29NO/c1-2-12-23-17-11-19-25(21-13-5-3-6-14-21)28(23)27(22-15-7-4-8-16-22)24-18-9-10-20-26(24)29/h2-10,13-16,18,20,23,25,27,29H,1,11-12,17,19H2/t23-,25-,27?/m1/s1.
What are the key properties of 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol?
2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol has a molecular weight of 383.54 g/mol, XLogP of 6.65, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(S)-phenyl-[(2R,6S)-2-phenyl-6-prop-2-enylpiperidin-1-yl]methyl]phenol is sourced from PubChem (CID 66524567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).