C26H48O5Si2 — CID 66524636
(E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-8-trimethylsilyloct-1-en-7-yne-3,4-diol (PubChem CID 66524636) has the molecular formula C26H48O5Si2 and a molecular weight of 496.84 g/mol. Its IUPAC name is (E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-8-trimethylsilyloct-1-en-7-yne-3,4-diol.
| Compound Name | (E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-8-trimethylsilyloct-1-en-7-yne-3,4-diol |
|---|---|
| PubChem CID | 66524636 |
| Molecular Formula | C26H48O5Si2 |
| Molecular Weight | 496.84 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | (E,3R,4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]-8-trimethylsilyloct-1-en-7-yne-3,4-diol |
| SMILES | CC(C)O[C@H]1C=CC[C@H](/C=C/[C@@](C)(O)[C@H](O)C[C@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H48O5Si2/c1-20(2)29-24-14-12-13-21(30-24)15-17-26(6,28)23(27)19-22(16-18-32(7,8)9)31-33(10,11)25(3,4)5/h12,14-15,17,20-24,27-28H,13,19H2,1-11H3/b17-15+/t21-,22+,23-,24-,26-/m1/s1 |
| InChIKey | OWICHKHXXXGBEN-AGLAATBJSA-N |
| XLogP | 5.41 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.84 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|