C17H28O2 — CID 66524676
(3E,6E)-5-(2-ethoxyethynyl)-2,4,6,8-tetramethylnona-3,6-dien-5-ol (PubChem CID 66524676) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (3E,6E)-5-(2-ethoxyethynyl)-2,4,6,8-tetramethylnona-3,6-dien-5-ol.
| Compound Name | (3E,6E)-5-(2-ethoxyethynyl)-2,4,6,8-tetramethylnona-3,6-dien-5-ol |
|---|---|
| PubChem CID | 66524676 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (3E,6E)-5-(2-ethoxyethynyl)-2,4,6,8-tetramethylnona-3,6-dien-5-ol |
| SMILES | CCOC#CC(O)(/C(C)=C/C(C)C)/C(C)=C/C(C)C |
| InChI | InChI=1S/C17H28O2/c1-8-19-10-9-17(18,15(6)11-13(2)3)16(7)12-14(4)5/h11-14,18H,8H2,1-7H3/b15-11+,16-12+ |
| InChIKey | VCSWHRAPVNAHLO-JOBJLJCHSA-N |
| XLogP | 3.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|