C11H17BN2O3S — CID 66524864
N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 66524864) has the molecular formula C11H17BN2O3S and a molecular weight of 268.15 g/mol. Its IUPAC name is N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 66524864 |
| Molecular Formula | C11H17BN2O3S |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C11H17BN2O3S/c1-7(15)14-9-13-6-8(18-9)12-16-10(2,3)11(4,5)17-12/h6H,1-5H3,(H,13,14,15) |
| InChIKey | CAWPWOIZCNGTJZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|