C15H19NO4 — CID 66524938
6,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 66524938) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 6,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 66524938 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6,7-dimethoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1cc2c(cc1OC)C(=O)CC1(CCNCC1)O2 |
| InChI | InChI=1S/C15H19NO4/c1-18-13-7-10-11(17)9-15(3-5-16-6-4-15)20-12(10)8-14(13)19-2/h7-8,16H,3-6,9H2,1-2H3 |
| InChIKey | YZNGBJNAUHZZOM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |