C18H22N4O4S — CID 665256
ethyl 2-[[2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]acetate (PubChem CID 665256) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is ethyl 2-[[2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 665256 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethyl 2-[[2-[[5-(3-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]acetate |
| SMILES | C=CCn1c(SCC(=O)NCC(=O)OCC)nnc1-c1cccc(OC)c1 |
| InChI | InChI=1S/C18H22N4O4S/c1-4-9-22-17(13-7-6-8-14(10-13)25-3)20-21-18(22)27-12-15(23)19-11-16(24)26-5-2/h4,6-8,10H,1,5,9,11-12H2,2-3H3,(H,19,23) |
| InChIKey | IDVCSSAQPKCMDI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|