C25H21N5O2 — CID 665284
(8S,8aR)-2-acetyl-6-amino-8-(4-methoxynaphthalen-1-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile (PubChem CID 665284) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is (8S,8aR)-2-acetyl-6-amino-8-(4-methoxynaphthalen-1-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (8S,8aR)-2-acetyl-6-amino-8-(4-methoxynaphthalen-1-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 665284 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | (8S,8aR)-2-acetyl-6-amino-8-(4-methoxynaphthalen-1-yl)-1,3,8,8a-tetrahydroisoquinoline-5,7,7-tricarbonitrile |
| SMILES | COc1ccc([C@@H]2[C@H]3CN(C(C)=O)CC=C3C(C#N)=C(N)C2(C#N)C#N)c2ccccc12 |
| InChI | InChI=1S/C25H21N5O2/c1-15(31)30-10-9-17-20(11-26)24(29)25(13-27,14-28)23(21(17)12-30)19-7-8-22(32-2)18-6-4-3-5-16(18)19/h3-9,21,23H,10,12,29H2,1-2H3/t21-,23+/m0/s1 |
| InChIKey | JKQGNOSEFIWBII-JTHBVZDNSA-N |
| XLogP | 3.12 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|