C18H19Cl2NO2 — CID 66529595
N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]cyclopropanamine (PubChem CID 66529595) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 66529595 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[[2-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]cyclopropanamine |
| SMILES | COc1cc(CNC2CC2)c(Cl)cc1OCc1ccccc1Cl |
| InChI | InChI=1S/C18H19Cl2NO2/c1-22-17-8-13(10-21-14-6-7-14)16(20)9-18(17)23-11-12-4-2-3-5-15(12)19/h2-5,8-9,14,21H,6-7,10-11H2,1H3 |
| InChIKey | UHPAPFYFAMVMND-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |