C23H21ClN2O4 — CID 66539319
2-chloro-4-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid (PubChem CID 66539319) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is 2-chloro-4-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66539319 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-chloro-4-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylamino]benzoic acid |
| SMILES | Cc1ccc(NC(=O)COc2ccc(CNc3ccc(C(=O)O)c(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C23H21ClN2O4/c1-15-2-6-17(7-3-15)26-22(27)14-30-19-9-4-16(5-10-19)13-25-18-8-11-20(23(28)29)21(24)12-18/h2-12,25H,13-14H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | SEIHSZRWLBARSQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |