C16H23ClN4O2S — CID 66541930
4-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 66541930) has the molecular formula C16H23ClN4O2S and a molecular weight of 370.91 g/mol. Its IUPAC name is 4-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66541930 |
| Molecular Formula | C16H23ClN4O2S |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-[(2-chloro-5-ethoxy-4-propoxyphenyl)methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCOc1cc(Cl)c(CNn2c(CC)n[nH]c2=S)cc1OCC |
| InChI | InChI=1S/C16H23ClN4O2S/c1-4-7-23-14-9-12(17)11(8-13(14)22-6-3)10-18-21-15(5-2)19-20-16(21)24/h8-9,18H,4-7,10H2,1-3H3,(H,20,24) |
| InChIKey | GCDRPEHHIAFYQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|