About N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide
N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 665446) has the molecular formula C23H32N2O6S
and a molecular weight of 464.58 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| PubChem CID | 665446 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCCN2CCOCC2)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H32N2O6S/c1-28-20-6-8-21(9-7-20)32(26,27)25(12-4-11-24-13-15-31-16-14-24)18-19-5-10-22(29-2)23(17-19)30-3/h5-10,17H,4,11-16,18H2,1-3H3 |
| InChIKey | LQDRDRPBNJRSBA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (CID 665446) is N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide is COc1ccc(S(=O)(=O)N(CCCN2CCOCC2)Cc2ccc(OC)c(OC)c2)cc1.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide?
The InChIKey is LQDRDRPBNJRSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32N2O6S/c1-28-20-6-8-21(9-7-20)32(26,27)25(12-4-11-24-13-15-31-16-14-24)18-19-5-10-22(29-2)23(17-19)30-3/h5-10,17H,4,11-16,18H2,1-3H3.
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide?
N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide has a molecular weight of 464.58 g/mol, XLogP of 2.63, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-4-methoxy-N-(3-morpholin-4-ylpropyl)benzenesulfonamide is sourced from PubChem (CID 665446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).