About ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate
ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate (PubChem CID 66545092) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate |
| PubChem CID | 66545092 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C9H9N3O2/c1-2-14-9(13)7-6-3-4-10-8(6)12-5-11-7/h3-5H,2H2,1H3,(H,10,11,12) |
| InChIKey | WNWIDMDDPSFGQP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The IUPAC name of ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate (CID 66545092) is ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate.
What is the SMILES notation for ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The canonical SMILES for ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate is CCOC(=O)c1ncnc2[nH]ccc12.
What is the InChIKey of ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
The InChIKey is WNWIDMDDPSFGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-2-14-9(13)7-6-3-4-10-8(6)12-5-11-7/h3-5H,2H2,1H3,(H,10,11,12).
What are the key properties of ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate?
ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate has a molecular weight of 191.19 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7H-pyrrolo[2,3-d]pyrimidine-4-carboxylate is sourced from PubChem (CID 66545092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).