C13H8F6N2O2 — CID 66545150
ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate (PubChem CID 66545150) has the molecular formula C13H8F6N2O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate.
| Compound Name | ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 66545150 |
| Molecular Formula | C13H8F6N2O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | ethyl 5,7-bis(trifluoromethyl)-1,8-naphthyridine-2-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(C(F)(F)F)cc(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C13H8F6N2O2/c1-2-23-11(22)8-4-3-6-7(12(14,15)16)5-9(13(17,18)19)21-10(6)20-8/h3-5H,2H2,1H3 |
| InChIKey | SOGQRHUEDKQABR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |