About (2-amino-4,6-dichloropyrimidin-5-yl)methanol
(2-amino-4,6-dichloropyrimidin-5-yl)methanol (PubChem CID 66545193) has the molecular formula C5H5Cl2N3O
and a molecular weight of 194.02 g/mol. Its IUPAC name is (2-amino-4,6-dichloropyrimidin-5-yl)methanol.
Molecular Properties
| Compound Name | (2-amino-4,6-dichloropyrimidin-5-yl)methanol |
| PubChem CID | 66545193 |
| Molecular Formula | C5H5Cl2N3O |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 192.98 |
| IUPAC Name | (2-amino-4,6-dichloropyrimidin-5-yl)methanol |
| SMILES | Nc1nc(Cl)c(CO)c(Cl)n1 |
| InChI | InChI=1S/C5H5Cl2N3O/c6-3-2(1-11)4(7)10-5(8)9-3/h11H,1H2,(H2,8,9,10) |
| InChIKey | KNCSWCBPUXNVMR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-4,6-dichloropyrimidin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4,6-dichloropyrimidin-5-yl)methanol?
The IUPAC name of (2-amino-4,6-dichloropyrimidin-5-yl)methanol (CID 66545193) is (2-amino-4,6-dichloropyrimidin-5-yl)methanol.
What is the SMILES notation for (2-amino-4,6-dichloropyrimidin-5-yl)methanol?
The canonical SMILES for (2-amino-4,6-dichloropyrimidin-5-yl)methanol is Nc1nc(Cl)c(CO)c(Cl)n1.
What is the InChIKey of (2-amino-4,6-dichloropyrimidin-5-yl)methanol?
The InChIKey is KNCSWCBPUXNVMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5Cl2N3O/c6-3-2(1-11)4(7)10-5(8)9-3/h11H,1H2,(H2,8,9,10).
What are the key properties of (2-amino-4,6-dichloropyrimidin-5-yl)methanol?
(2-amino-4,6-dichloropyrimidin-5-yl)methanol has a molecular weight of 194.02 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4,6-dichloropyrimidin-5-yl)methanol is sourced from PubChem (CID 66545193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).