About 2,3-dimethoxy-4,5-dimethylbenzaldehyde
2,3-dimethoxy-4,5-dimethylbenzaldehyde (PubChem CID 66545575) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,3-dimethoxy-4,5-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 2,3-dimethoxy-4,5-dimethylbenzaldehyde |
| PubChem CID | 66545575 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2,3-dimethoxy-4,5-dimethylbenzaldehyde |
| SMILES | COc1c(C=O)cc(C)c(C)c1OC |
| InChI | InChI=1S/C11H14O3/c1-7-5-9(6-12)11(14-4)10(13-3)8(7)2/h5-6H,1-4H3 |
| InChIKey | JHKYTBPOWSSDPV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethoxy-4,5-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethoxy-4,5-dimethylbenzaldehyde?
The IUPAC name of 2,3-dimethoxy-4,5-dimethylbenzaldehyde (CID 66545575) is 2,3-dimethoxy-4,5-dimethylbenzaldehyde.
What is the SMILES notation for 2,3-dimethoxy-4,5-dimethylbenzaldehyde?
The canonical SMILES for 2,3-dimethoxy-4,5-dimethylbenzaldehyde is COc1c(C=O)cc(C)c(C)c1OC.
What is the InChIKey of 2,3-dimethoxy-4,5-dimethylbenzaldehyde?
The InChIKey is JHKYTBPOWSSDPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-7-5-9(6-12)11(14-4)10(13-3)8(7)2/h5-6H,1-4H3.
What are the key properties of 2,3-dimethoxy-4,5-dimethylbenzaldehyde?
2,3-dimethoxy-4,5-dimethylbenzaldehyde has a molecular weight of 194.23 g/mol, XLogP of 2.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethoxy-4,5-dimethylbenzaldehyde is sourced from PubChem (CID 66545575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).