About 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one
2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one (PubChem CID 66545744) has the molecular formula C21H21N3O
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one |
| PubChem CID | 66545744 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one |
| SMILES | Cc1cccc(-c2ccc([C@@H]3C[C@@H]3c3cc(=O)n(C)c(N)n3)cc2)c1 |
| InChI | InChI=1S/C21H21N3O/c1-13-4-3-5-16(10-13)14-6-8-15(9-7-14)17-11-18(17)19-12-20(25)24(2)21(22)23-19/h3-10,12,17-18H,11H2,1-2H3,(H2,22,23)/t17-,18-/m0/s1 |
| InChIKey | STUBOTPNCNDBOA-ROUUACIJSA-N |
| XLogP | 3.61 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one?
The IUPAC name of 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one (CID 66545744) is 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one.
What is the SMILES notation for 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one?
The canonical SMILES for 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one is Cc1cccc(-c2ccc([C@@H]3C[C@@H]3c3cc(=O)n(C)c(N)n3)cc2)c1.
What is the InChIKey of 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one?
The InChIKey is STUBOTPNCNDBOA-ROUUACIJSA-N. The full InChI is InChI=1S/C21H21N3O/c1-13-4-3-5-16(10-13)14-6-8-15(9-7-14)17-11-18(17)19-12-20(25)24(2)21(22)23-19/h3-10,12,17-18H,11H2,1-2H3,(H2,22,23)/t17-,18-/m0/s1.
What are the key properties of 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one?
2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one has a molecular weight of 331.42 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-6-[(1S,2R)-2-[4-(3-methylphenyl)phenyl]cyclopropyl]pyrimidin-4-one is sourced from PubChem (CID 66545744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).