About (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride
(2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride (PubChem CID 66545991) has the molecular formula C12H25ClN2O2S
and a molecular weight of 296.86 g/mol. Its IUPAC name is (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride.
Molecular Properties
| Compound Name | (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride |
| PubChem CID | 66545991 |
| Molecular Formula | C12H25ClN2O2S |
| Molecular Weight | 296.86 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride |
| SMILES | C[C@H](NCC(C)(C)CO)C(=O)N1CCSCC1.Cl |
| InChI | InChI=1S/C12H24N2O2S.ClH/c1-10(13-8-12(2,3)9-15)11(16)14-4-6-17-7-5-14;/h10,13,15H,4-9H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | DIGWEAVYITYJKR-PPHPATTJSA-N |
| XLogP | 0.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.86 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride?
The IUPAC name of (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride (CID 66545991) is (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride.
What is the SMILES notation for (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride?
The canonical SMILES for (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride is C[C@H](NCC(C)(C)CO)C(=O)N1CCSCC1.Cl.
What is the InChIKey of (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride?
The InChIKey is DIGWEAVYITYJKR-PPHPATTJSA-N. The full InChI is InChI=1S/C12H24N2O2S.ClH/c1-10(13-8-12(2,3)9-15)11(16)14-4-6-17-7-5-14;/h10,13,15H,4-9H2,1-3H3;1H/t10-;/m0./s1.
What are the key properties of (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride?
(2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride has a molecular weight of 296.86 g/mol, XLogP of 0.98, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(3-hydroxy-2,2-dimethylpropyl)amino]-1-thiomorpholin-4-ylpropan-1-one;hydrochloride is sourced from PubChem (CID 66545991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).