C23H38N8O4 — CID 66546136
(3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[2-[3-(dimethylamino)propylamino]pyrimidin-4-yl]pyrazolidine-3-carboxamide (PubChem CID 66546136) has the molecular formula C23H38N8O4 and a molecular weight of 490.61 g/mol. Its IUPAC name is (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[2-[3-(dimethylamino)propylamino]pyrimidin-4-yl]pyrazolidine-3-carboxamide.
| Compound Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[2-[3-(dimethylamino)propylamino]pyrimidin-4-yl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 66546136 |
| Molecular Formula | C23H38N8O4 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | (3S)-2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-[2-[3-(dimethylamino)propylamino]pyrimidin-4-yl]pyrazolidine-3-carboxamide |
| SMILES | CN(C)CCCNc1nccc(NC(=O)[C@@H]2CCNN2C(=O)[C@H](CC2CCCC2)CN(O)C=O)n1 |
| InChI | InChI=1S/C23H38N8O4/c1-29(2)13-5-10-24-23-25-11-9-20(28-23)27-21(33)19-8-12-26-31(19)22(34)18(15-30(35)16-32)14-17-6-3-4-7-17/h9,11,16-19,26,35H,3-8,10,12-15H2,1-2H3,(H2,24,25,27,28,33)/t18-,19+/m1/s1 |
| InChIKey | OSIPHYMKTIHEFK-MOPGFXCFSA-N |
| XLogP | 0.93 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|