About N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide
N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide (PubChem CID 66546338) has the molecular formula C23H22N2O4S
and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide.
Molecular Properties
| Compound Name | N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide |
| PubChem CID | 66546338 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide |
| SMILES | COc1ccc(-c2ccc(CNS(=O)(=O)c3cc4ccccc4[nH]3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H22N2O4S/c1-28-19-11-12-20(22(14-19)29-2)17-9-7-16(8-10-17)15-24-30(26,27)23-13-18-5-3-4-6-21(18)25-23/h3-14,24-25H,15H2,1-2H3 |
| InChIKey | PATRWRLGIAZSFB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The IUPAC name of N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide (CID 66546338) is N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide.
What is the SMILES notation for N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The canonical SMILES for N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide is COc1ccc(-c2ccc(CNS(=O)(=O)c3cc4ccccc4[nH]3)cc2)c(OC)c1.
What is the InChIKey of N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
The InChIKey is PATRWRLGIAZSFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O4S/c1-28-19-11-12-20(22(14-19)29-2)17-9-7-16(8-10-17)15-24-30(26,27)23-13-18-5-3-4-6-21(18)25-23/h3-14,24-25H,15H2,1-2H3.
What are the key properties of N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide?
N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide has a molecular weight of 422.51 g/mol, XLogP of 4.33, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2,4-dimethoxyphenyl)phenyl]methyl]-1H-indole-2-sulfonamide is sourced from PubChem (CID 66546338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).