C25H27Cl2NO6 — CID 66546400
(2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate (PubChem CID 66546400) has the molecular formula C25H27Cl2NO6 and a molecular weight of 508.40 g/mol. Its IUPAC name is (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate.
| Compound Name | (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 66546400 |
| Molecular Formula | C25H27Cl2NO6 |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | (2-hydroxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl) 2-acetyloxy-5-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzoate |
| SMILES | CC(=O)Oc1ccc(NCc2cc(Cl)cc(Cl)c2O)cc1C(=O)OC12CCC(CC1O)C2(C)C |
| InChI | InChI=1S/C25H27Cl2NO6/c1-13(29)33-20-5-4-17(28-12-14-8-16(26)10-19(27)22(14)31)11-18(20)23(32)34-25-7-6-15(9-21(25)30)24(25,2)3/h4-5,8,10-11,15,21,28,30-31H,6-7,9,12H2,1-3H3 |
| InChIKey | CWVGAXOWSLUSKK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|